C22H34N6O2 — CID 164885413
5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 164885413) has the molecular formula C22H34N6O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 164885413 |
| Molecular Formula | C22H34N6O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 5-[4-[(2-ethyl-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CCC1NC2CCC(CN3CCN(c4ccc(C(=O)NC)nc4)CC3)CC2NC1=O |
| InChI | InChI=1S/C22H34N6O2/c1-3-17-22(30)26-20-12-15(4-6-18(20)25-17)14-27-8-10-28(11-9-27)16-5-7-19(24-13-16)21(29)23-2/h5,7,13,15,17-18,20,25H,3-4,6,8-12,14H2,1-2H3,(H,23,29)(H,26,30) |
| InChIKey | NIBHUZUPYHRNDI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |