C22H32F2N6O2 — CID 164885427
6-fluoro-5-[4-[[2-(2-fluoroethyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (PubChem CID 164885427) has the molecular formula C22H32F2N6O2 and a molecular weight of 450.53 g/mol. Its IUPAC name is 6-fluoro-5-[4-[[2-(2-fluoroethyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-fluoro-5-[4-[[2-(2-fluoroethyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 164885427 |
| Molecular Formula | C22H32F2N6O2 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 6-fluoro-5-[4-[[2-(2-fluoroethyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(CC3CCC4NC(CCF)C(=O)NC4C3)CC2)c(F)n1 |
| InChI | InChI=1S/C22H32F2N6O2/c1-25-21(31)16-4-5-19(20(24)27-16)30-10-8-29(9-11-30)13-14-2-3-15-18(12-14)28-22(32)17(26-15)6-7-23/h4-5,14-15,17-18,26H,2-3,6-13H2,1H3,(H,25,31)(H,28,32) |
| InChIKey | WHVWTKVPENTALP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|