C22H31F3N6O2 — CID 164885428
N-methyl-5-[4-[[3-oxo-2-(2,2,2-trifluoroethyl)-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]pyridine-2-carboxamide (PubChem CID 164885428) has the molecular formula C22H31F3N6O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is N-methyl-5-[4-[[3-oxo-2-(2,2,2-trifluoroethyl)-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-methyl-5-[4-[[3-oxo-2-(2,2,2-trifluoroethyl)-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 164885428 |
| Molecular Formula | C22H31F3N6O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-methyl-5-[4-[[3-oxo-2-(2,2,2-trifluoroethyl)-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(CC3CCC4NC(CC(F)(F)F)C(=O)NC4C3)CC2)cn1 |
| InChI | InChI=1S/C22H31F3N6O2/c1-26-20(32)17-5-3-15(12-27-17)31-8-6-30(7-9-31)13-14-2-4-16-18(10-14)29-21(33)19(28-16)11-22(23,24)25/h3,5,12,14,16,18-19,28H,2,4,6-11,13H2,1H3,(H,26,32)(H,29,33) |
| InChIKey | DOROQZGGPMNIHJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |