C16H11ClN2OS — CID 164885631
7-chloro-1-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole (PubChem CID 164885631) has the molecular formula C16H11ClN2OS and a molecular weight of 314.80 g/mol. Its IUPAC name is 7-chloro-1-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 7-chloro-1-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 164885631 |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 7-chloro-1-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole |
| SMILES | COc1ccc(-c2cnc3sc4ccc(Cl)cc4n23)cc1 |
| InChI | InChI=1S/C16H11ClN2OS/c1-20-12-5-2-10(3-6-12)14-9-18-16-19(14)13-8-11(17)4-7-15(13)21-16/h2-9H,1H3 |
| InChIKey | HXXLOCNNYQEMCY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |