C16H12ClNOS — CID 21408740
2-chloro-5-[4-(4-methoxyphenyl)phenyl]-1,3-thiazole (PubChem CID 21408740) has the molecular formula C16H12ClNOS and a molecular weight of 301.80 g/mol. Its IUPAC name is 2-chloro-5-[4-(4-methoxyphenyl)phenyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[4-(4-methoxyphenyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 21408740 |
| Molecular Formula | C16H12ClNOS |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-chloro-5-[4-(4-methoxyphenyl)phenyl]-1,3-thiazole |
| SMILES | COc1ccc(-c2ccc(-c3cnc(Cl)s3)cc2)cc1 |
| InChI | InChI=1S/C16H12ClNOS/c1-19-14-8-6-12(7-9-14)11-2-4-13(5-3-11)15-10-18-16(17)20-15/h2-10H,1H3 |
| InChIKey | UTWQXZDSDWVYMY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |