C12H11NO2S — CID 166892998
1-[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanone (PubChem CID 166892998) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 1-[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 1-[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 166892998 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1-[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethanone |
| SMILES | COc1ccc(-c2cnc(C(C)=O)s2)cc1 |
| InChI | InChI=1S/C12H11NO2S/c1-8(14)12-13-7-11(16-12)9-3-5-10(15-2)6-4-9/h3-7H,1-2H3 |
| InChIKey | FVNHKZXGDVCEFL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |