C13H17N3OS — CID 53272462
2-[[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine (PubChem CID 53272462) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-[[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 53272462 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-1,1-dimethylhydrazine |
| SMILES | COc1ccc(-c2cnc(CNN(C)C)s2)cc1 |
| InChI | InChI=1S/C13H17N3OS/c1-16(2)15-9-13-14-8-12(18-13)10-4-6-11(17-3)7-5-10/h4-8,15H,9H2,1-3H3 |
| InChIKey | XOQMJTQOBCHRMO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|