C6H7F2IN2O — CID 164885857
1-(2,2-difluoroethyl)-4-iodo-3-methoxypyrazole (PubChem CID 164885857) has the molecular formula C6H7F2IN2O and a molecular weight of 288.04 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-iodo-3-methoxypyrazole.
| Compound Name | 1-(2,2-difluoroethyl)-4-iodo-3-methoxypyrazole |
|---|---|
| PubChem CID | 164885857 |
| Molecular Formula | C6H7F2IN2O |
| Molecular Weight | 288.04 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-iodo-3-methoxypyrazole |
| SMILES | COc1nn(CC(F)F)cc1I |
| InChI | InChI=1S/C6H7F2IN2O/c1-12-6-4(9)2-11(10-6)3-5(7)8/h2,5H,3H2,1H3 |
| InChIKey | MZSNDRUXEGBMCC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.04 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|