C15H22FN — CID 164887975
(E)-3-(4-fluorophenyl)-N,N-dipropylprop-2-en-1-amine (PubChem CID 164887975) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N,N-dipropylprop-2-en-1-amine.
| Compound Name | (E)-3-(4-fluorophenyl)-N,N-dipropylprop-2-en-1-amine |
|---|---|
| PubChem CID | 164887975 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N,N-dipropylprop-2-en-1-amine |
| SMILES | CCCN(C/C=C/c1ccc(F)cc1)CCC |
| InChI | InChI=1S/C15H22FN/c1-3-11-17(12-4-2)13-5-6-14-7-9-15(16)10-8-14/h5-10H,3-4,11-13H2,1-2H3/b6-5+ |
| InChIKey | OMWGLGDQTQCKOJ-AATRIKPKSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |