About N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine
N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine (PubChem CID 151263104) has the molecular formula C17H19FN2
and a molecular weight of 270.35 g/mol. Its IUPAC name is N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine.
Molecular Properties
| Compound Name | N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine |
| PubChem CID | 151263104 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine |
| SMILES | CN(CC=Cc1ccc(F)cc1)C(N)c1ccccc1 |
| InChI | InChI=1S/C17H19FN2/c1-20(17(19)15-7-3-2-4-8-15)13-5-6-14-9-11-16(18)12-10-14/h2-12,17H,13,19H2,1H3 |
| InChIKey | NUTLCEBLNRMETK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine?
The IUPAC name of N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine (CID 151263104) is N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine.
What is the SMILES notation for N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine?
The canonical SMILES for N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine is CN(CC=Cc1ccc(F)cc1)C(N)c1ccccc1.
What is the InChIKey of N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine?
The InChIKey is NUTLCEBLNRMETK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN2/c1-20(17(19)15-7-3-2-4-8-15)13-5-6-14-9-11-16(18)12-10-14/h2-12,17H,13,19H2,1H3.
What are the key properties of N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine?
N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine has a molecular weight of 270.35 g/mol, XLogP of 3.43, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(4-fluorophenyl)prop-2-enyl]-N'-methyl-1-phenylmethanediamine is sourced from PubChem (CID 151263104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).