C19H33N3O5 — CID 164889214
methyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-2-(prop-2-enoylamino)propanoyl]amino]pentanoyl]amino]pentanoate (PubChem CID 164889214) has the molecular formula C19H33N3O5 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-2-(prop-2-enoylamino)propanoyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-2-(prop-2-enoylamino)propanoyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 164889214 |
| Molecular Formula | C19H33N3O5 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-2-(prop-2-enoylamino)propanoyl]amino]pentanoyl]amino]pentanoate |
| SMILES | C=CC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C19H33N3O5/c1-8-16(23)20-13(6)17(24)21-14(9-11(2)3)18(25)22-15(10-12(4)5)19(26)27-7/h8,11-15H,1,9-10H2,2-7H3,(H,20,23)(H,21,24)(H,22,25)/t13-,14-,15-/m0/s1 |
| InChIKey | SATXWRIXVBUEHE-KKUMJFAQSA-N |
| XLogP | 0.91 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|