C27H33N5S2 — CID 164889593
[(E)-[(1S,2R,13R,14S,18S)-7-anilino-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ylidene]amino]thiourea (PubChem CID 164889593) has the molecular formula C27H33N5S2 and a molecular weight of 491.73 g/mol. Its IUPAC name is [(E)-[(1S,2R,13R,14S,18S)-7-anilino-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ylidene]amino]thiourea.
| Compound Name | [(E)-[(1S,2R,13R,14S,18S)-7-anilino-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 164889593 |
| Molecular Formula | C27H33N5S2 |
| Molecular Weight | 491.73 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [(E)-[(1S,2R,13R,14S,18S)-7-anilino-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ylidene]amino]thiourea |
| SMILES | C[C@]12CCc3nc(Nc4ccccc4)sc3C1=CC[C@@H]1[C@@H]2CC[C@]2(C)/C(=N/NC(N)=S)CC[C@@H]12 |
| InChI | InChI=1S/C27H33N5S2/c1-26-15-13-21-23(34-25(30-21)29-16-6-4-3-5-7-16)20(26)9-8-17-18-10-11-22(31-32-24(28)33)27(18,2)14-12-19(17)26/h3-7,9,17-19H,8,10-15H2,1-2H3,(H,29,30)(H3,28,32,33)/b31-22+/t17-,18-,19-,26+,27-/m0/s1 |
| InChIKey | FDDHBXRBZHRLPV-NAKIHURPSA-N |
| XLogP | 6.26 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|