C26H34N4O3 — CID 164890408
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[[4-hydroxy-3-methoxy-5-[(3-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]acetamide (PubChem CID 164890408) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[[4-hydroxy-3-methoxy-5-[(3-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[[4-hydroxy-3-methoxy-5-[(3-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 164890408 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[[4-hydroxy-3-methoxy-5-[(3-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]acetamide |
| SMILES | COc1cc(C=NNC(=O)CN2CCc3ccccc3C2)cc(CN2CCCC(C)C2)c1O |
| InChI | InChI=1S/C26H34N4O3/c1-19-6-5-10-29(15-19)17-23-12-20(13-24(33-2)26(23)32)14-27-28-25(31)18-30-11-9-21-7-3-4-8-22(21)16-30/h3-4,7-8,12-14,19,32H,5-6,9-11,15-18H2,1-2H3,(H,28,31) |
| InChIKey | PNSFFZNTDDBLGK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|