C27H37N5O3 — CID 164890413
N-[[4-hydroxy-3-methoxy-5-[(3-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-2-(4-phenylpiperazin-1-yl)acetamide (PubChem CID 164890413) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-[[4-hydroxy-3-methoxy-5-[(3-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-2-(4-phenylpiperazin-1-yl)acetamide.
| Compound Name | N-[[4-hydroxy-3-methoxy-5-[(3-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-2-(4-phenylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 164890413 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | N-[[4-hydroxy-3-methoxy-5-[(3-methylpiperidin-1-yl)methyl]phenyl]methylideneamino]-2-(4-phenylpiperazin-1-yl)acetamide |
| SMILES | COc1cc(C=NNC(=O)CN2CCN(c3ccccc3)CC2)cc(CN2CCCC(C)C2)c1O |
| InChI | InChI=1S/C27H37N5O3/c1-21-7-6-10-31(18-21)19-23-15-22(16-25(35-2)27(23)34)17-28-29-26(33)20-30-11-13-32(14-12-30)24-8-4-3-5-9-24/h3-5,8-9,15-17,21,34H,6-7,10-14,18-20H2,1-2H3,(H,29,33) |
| InChIKey | RZUNYZIUVBUVLR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|