C9H8BFO4 — CID 164890753
3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid (PubChem CID 164890753) has the molecular formula C9H8BFO4 and a molecular weight of 209.97 g/mol. Its IUPAC name is 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid.
| Compound Name | 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 164890753 |
| Molecular Formula | C9H8BFO4 |
| Molecular Weight | 209.97 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)cc(B2OCCO2)c1 |
| InChI | InChI=1S/C9H8BFO4/c11-8-4-6(9(12)13)3-7(5-8)10-14-1-2-15-10/h3-5H,1-2H2,(H,12,13) |
| InChIKey | MSHCTKCHGGEFJF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.97 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|