3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid

C9H8BFO4 — CID 164890753

IUPAC3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid
SMILESO=C(O)c1cc(F)cc(B2OCCO2)c1
InChIInChI=1S/C9H8BFO4/c11-8-4-6(9(12)13)3-7(5-8)10-14-1-2-15-10/h3-5H,1-2H2,(H,12,13)
InChIKeyMSHCTKCHGGEFJF-UHFFFAOYSA-N
MW209.97 g/mol
LogP0.27
Rot. Bonds2

About 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid

3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid (PubChem CID 164890753) has the molecular formula C9H8BFO4 and a molecular weight of 209.97 g/mol. Its IUPAC name is 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid.

Molecular Properties

Compound Name3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid
PubChem CID164890753
Molecular FormulaC9H8BFO4
Molecular Weight209.97 g/mol
Exact Mass210.05
IUPAC Name3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid
SMILESO=C(O)c1cc(F)cc(B2OCCO2)c1
InChIInChI=1S/C9H8BFO4/c11-8-4-6(9(12)13)3-7(5-8)10-14-1-2-15-10/h3-5H,1-2H2,(H,12,13)
InChIKeyMSHCTKCHGGEFJF-UHFFFAOYSA-N
XLogP0.27
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.97
LogP ≤ 50.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid?
The IUPAC name of 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid (CID 164890753) is 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid.
What is the SMILES notation for 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid?
The canonical SMILES for 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid is O=C(O)c1cc(F)cc(B2OCCO2)c1.
What is the InChIKey of 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid?
The InChIKey is MSHCTKCHGGEFJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BFO4/c11-8-4-6(9(12)13)3-7(5-8)10-14-1-2-15-10/h3-5H,1-2H2,(H,12,13).
What are the key properties of 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid?
3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid has a molecular weight of 209.97 g/mol, XLogP of 0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3,2-dioxaborolan-2-yl)-5-fluorobenzoic acid is sourced from PubChem (CID 164890753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).