C11H13Cl2FO2 — CID 164893818
2,2-dichloro-1-(2-fluoro-6-propan-2-yloxyphenyl)ethanol (PubChem CID 164893818) has the molecular formula C11H13Cl2FO2 and a molecular weight of 267.13 g/mol. Its IUPAC name is 2,2-dichloro-1-(2-fluoro-6-propan-2-yloxyphenyl)ethanol.
| Compound Name | 2,2-dichloro-1-(2-fluoro-6-propan-2-yloxyphenyl)ethanol |
|---|---|
| PubChem CID | 164893818 |
| Molecular Formula | C11H13Cl2FO2 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2,2-dichloro-1-(2-fluoro-6-propan-2-yloxyphenyl)ethanol |
| SMILES | CC(C)Oc1cccc(F)c1C(O)C(Cl)Cl |
| InChI | InChI=1S/C11H13Cl2FO2/c1-6(2)16-8-5-3-4-7(14)9(8)10(15)11(12)13/h3-6,10-11,15H,1-2H3 |
| InChIKey | GGJSQKGREREIDB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|