C9H5BrF4O — CID 164895160
1-(5-bromo-2,3-difluoro-4-methylphenyl)-2,2-difluoroethanone (PubChem CID 164895160) has the molecular formula C9H5BrF4O and a molecular weight of 285.03 g/mol. Its IUPAC name is 1-(5-bromo-2,3-difluoro-4-methylphenyl)-2,2-difluoroethanone.
| Compound Name | 1-(5-bromo-2,3-difluoro-4-methylphenyl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 164895160 |
| Molecular Formula | C9H5BrF4O |
| Molecular Weight | 285.03 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | 1-(5-bromo-2,3-difluoro-4-methylphenyl)-2,2-difluoroethanone |
| SMILES | Cc1c(Br)cc(C(=O)C(F)F)c(F)c1F |
| InChI | InChI=1S/C9H5BrF4O/c1-3-5(10)2-4(7(12)6(3)11)8(15)9(13)14/h2,9H,1H3 |
| InChIKey | MJBVNVMQHUWYLE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.03 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|