C13H19N3O3 — CID 164895631
N-cyclohexyl-3,6-dimethoxypyridazine-4-carboxamide (PubChem CID 164895631) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-cyclohexyl-3,6-dimethoxypyridazine-4-carboxamide.
| Compound Name | N-cyclohexyl-3,6-dimethoxypyridazine-4-carboxamide |
|---|---|
| PubChem CID | 164895631 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-cyclohexyl-3,6-dimethoxypyridazine-4-carboxamide |
| SMILES | COc1cc(C(=O)NC2CCCCC2)c(OC)nn1 |
| InChI | InChI=1S/C13H19N3O3/c1-18-11-8-10(13(19-2)16-15-11)12(17)14-9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,14,17) |
| InChIKey | AKRYGJQLTQNQQH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |