C28H24N2O3 — CID 164897797
methyl (E)-6-oxo-5-(4-phenylphenyl)-6-(quinolin-8-ylamino)hex-2-enoate (PubChem CID 164897797) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl (E)-6-oxo-5-(4-phenylphenyl)-6-(quinolin-8-ylamino)hex-2-enoate.
| Compound Name | methyl (E)-6-oxo-5-(4-phenylphenyl)-6-(quinolin-8-ylamino)hex-2-enoate |
|---|---|
| PubChem CID | 164897797 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | methyl (E)-6-oxo-5-(4-phenylphenyl)-6-(quinolin-8-ylamino)hex-2-enoate |
| SMILES | COC(=O)/C=C/CC(C(=O)Nc1cccc2cccnc12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2O3/c1-33-26(31)14-6-12-24(22-17-15-21(16-18-22)20-8-3-2-4-9-20)28(32)30-25-13-5-10-23-11-7-19-29-27(23)25/h2-11,13-19,24H,12H2,1H3,(H,30,32)/b14-6+ |
| InChIKey | VCGOAOSELHAUKQ-MKMNVTDBSA-N |
| XLogP | 5.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|