About CID 164898393
CID 164898393 (PubChem CID 164898393) has the molecular formula C13H18OSi
and a molecular weight of 218.37 g/mol.
Molecular Properties
| Compound Name | CID 164898393 |
| PubChem CID | 164898393 |
| Molecular Formula | C13H18OSi |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | — |
| SMILES | COc1ccccc1[Si]C1CCCCC1 |
| InChI | InChI=1S/C13H18OSi/c1-14-12-9-5-6-10-13(12)15-11-7-3-2-4-8-11/h5-6,9-11H,2-4,7-8H2,1H3 |
| InChIKey | MUUONFAYLFQYOA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 164898393 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164898393?
The IUPAC name of CID 164898393 (CID 164898393) is not available.
What is the SMILES notation for CID 164898393?
The canonical SMILES for CID 164898393 is COc1ccccc1[Si]C1CCCCC1.
What is the InChIKey of CID 164898393?
The InChIKey is MUUONFAYLFQYOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18OSi/c1-14-12-9-5-6-10-13(12)15-11-7-3-2-4-8-11/h5-6,9-11H,2-4,7-8H2,1H3.
What are the key properties of CID 164898393?
CID 164898393 has a molecular weight of 218.37 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164898393 is sourced from PubChem (CID 164898393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).