C24H27N5O5 — CID 164899229
benzyl 4-[3-[(7-methyl-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)amino]propanoyloxy]piperidine-1-carboxylate (PubChem CID 164899229) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is benzyl 4-[3-[(7-methyl-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)amino]propanoyloxy]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[3-[(7-methyl-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)amino]propanoyloxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164899229 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | benzyl 4-[3-[(7-methyl-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)amino]propanoyloxy]piperidine-1-carboxylate |
| SMILES | Cc1ccc2nc(NCCC(=O)OC3CCN(C(=O)OCc4ccccc4)CC3)n[n+]([O-])c2c1 |
| InChI | InChI=1S/C24H27N5O5/c1-17-7-8-20-21(15-17)29(32)27-23(26-20)25-12-9-22(30)34-19-10-13-28(14-11-19)24(31)33-16-18-5-3-2-4-6-18/h2-8,15,19H,9-14,16H2,1H3,(H,25,26,27) |
| InChIKey | HYZALRMIEHQDPK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|