C16H19BrF2N4O2 — CID 164903049
tert-butyl N-[[2-(3-bromo-2,4-difluorophenyl)-5-methyl-1,2,4-triazol-3-yl]methyl]-N-methylcarbamate (PubChem CID 164903049) has the molecular formula C16H19BrF2N4O2 and a molecular weight of 417.25 g/mol. Its IUPAC name is tert-butyl N-[[2-(3-bromo-2,4-difluorophenyl)-5-methyl-1,2,4-triazol-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[2-(3-bromo-2,4-difluorophenyl)-5-methyl-1,2,4-triazol-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 164903049 |
| Molecular Formula | C16H19BrF2N4O2 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | tert-butyl N-[[2-(3-bromo-2,4-difluorophenyl)-5-methyl-1,2,4-triazol-3-yl]methyl]-N-methylcarbamate |
| SMILES | Cc1nc(CN(C)C(=O)OC(C)(C)C)n(-c2ccc(F)c(Br)c2F)n1 |
| InChI | InChI=1S/C16H19BrF2N4O2/c1-9-20-12(8-22(5)15(24)25-16(2,3)4)23(21-9)11-7-6-10(18)13(17)14(11)19/h6-7H,8H2,1-5H3 |
| InChIKey | XBSLFBZZAPJFNP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|