C11H11ClN4O2 — CID 164903118
10-chloro-4,8-dimethyl-2,3,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,7-diol (PubChem CID 164903118) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 10-chloro-4,8-dimethyl-2,3,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,7-diol.
| Compound Name | 10-chloro-4,8-dimethyl-2,3,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,7-diol |
|---|---|
| PubChem CID | 164903118 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 10-chloro-4,8-dimethyl-2,3,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,7-diol |
| SMILES | Cc1cc2n(n1)-c1ccnc(Cl)c1N(C)C2(O)O |
| InChI | InChI=1S/C11H11ClN4O2/c1-6-5-8-11(17,18)15(2)9-7(16(8)14-6)3-4-13-10(9)12/h3-5,17-18H,1-2H3 |
| InChIKey | UBZKLYNGCFQGBL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|