About 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane
3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane (PubChem CID 165393306) has the molecular formula C13H18ClN3
and a molecular weight of 251.76 g/mol. Its IUPAC name is 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane.
Molecular Properties
| Compound Name | 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane |
| PubChem CID | 165393306 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane |
| SMILES | CC.Cc1cc(C)n(-c2nccc(C)c2Cl)n1 |
| InChI | InChI=1S/C11H12ClN3.C2H6/c1-7-4-5-13-11(10(7)12)15-9(3)6-8(2)14-15;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | ATLNMWSYOYECTD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane?
The IUPAC name of 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane (CID 165393306) is 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane.
What is the SMILES notation for 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane?
The canonical SMILES for 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane is CC.Cc1cc(C)n(-c2nccc(C)c2Cl)n1.
What is the InChIKey of 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane?
The InChIKey is ATLNMWSYOYECTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3.C2H6/c1-7-4-5-13-11(10(7)12)15-9(3)6-8(2)14-15;1-2/h4-6H,1-3H3;1-2H3.
What are the key properties of 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane?
3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane has a molecular weight of 251.76 g/mol, XLogP of 3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine;ethane is sourced from PubChem (CID 165393306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).