C9H9ClN4 — CID 105370840
5-chloro-4-(3,5-dimethylpyrazol-1-yl)pyrimidine (PubChem CID 105370840) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 5-chloro-4-(3,5-dimethylpyrazol-1-yl)pyrimidine.
| Compound Name | 5-chloro-4-(3,5-dimethylpyrazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 105370840 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 5-chloro-4-(3,5-dimethylpyrazol-1-yl)pyrimidine |
| SMILES | Cc1cc(C)n(-c2ncncc2Cl)n1 |
| InChI | InChI=1S/C9H9ClN4/c1-6-3-7(2)14(13-6)9-8(10)4-11-5-12-9/h3-5H,1-2H3 |
| InChIKey | NGXYBOLRFPLXQR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |