C11H12ClN5O — CID 170348157
(7S)-10-chloro-4,7,8-trimethyl-2,4,5,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),5,10,12-tetraen-3-one (PubChem CID 170348157) has the molecular formula C11H12ClN5O and a molecular weight of 265.70 g/mol. Its IUPAC name is (7S)-10-chloro-4,7,8-trimethyl-2,4,5,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),5,10,12-tetraen-3-one.
| Compound Name | (7S)-10-chloro-4,7,8-trimethyl-2,4,5,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),5,10,12-tetraen-3-one |
|---|---|
| PubChem CID | 170348157 |
| Molecular Formula | C11H12ClN5O |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (7S)-10-chloro-4,7,8-trimethyl-2,4,5,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),5,10,12-tetraen-3-one |
| SMILES | C[C@H]1c2nn(C)c(=O)n2-c2ccnc(Cl)c2N1C |
| InChI | InChI=1S/C11H12ClN5O/c1-6-10-14-16(3)11(18)17(10)7-4-5-13-9(12)8(7)15(6)2/h4-6H,1-3H3/t6-/m0/s1 |
| InChIKey | JIAISYDRQZTUQQ-LURJTMIESA-N |
| XLogP | 1.13 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|