C19H16F3N3O2S — CID 164903608
N-[3-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-yl)-4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylmethanamine (PubChem CID 164903608) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is N-[3-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-yl)-4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylmethanamine.
| Compound Name | N-[3-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-yl)-4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylmethanamine |
|---|---|
| PubChem CID | 164903608 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[3-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-yl)-4-[4-(trifluoromethyl)phenoxy]phenyl]sulfanylmethanamine |
| SMILES | CNSc1ccc(Oc2ccc(C(F)(F)F)cc2)c(-c2cnn3c2OCC3)c1 |
| InChI | InChI=1S/C19H16F3N3O2S/c1-23-28-14-6-7-17(27-13-4-2-12(3-5-13)19(20,21)22)15(10-14)16-11-24-25-8-9-26-18(16)25/h2-7,10-11,23H,8-9H2,1H3 |
| InChIKey | ISWQBGGKVWYQSB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|