C9H22N2 — CID 164904627
ethane;3-ethyl-N,1-dimethylazetidin-3-amine (PubChem CID 164904627) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is ethane;3-ethyl-N,1-dimethylazetidin-3-amine.
| Compound Name | ethane;3-ethyl-N,1-dimethylazetidin-3-amine |
|---|---|
| PubChem CID | 164904627 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | ethane;3-ethyl-N,1-dimethylazetidin-3-amine |
| SMILES | CC.CCC1(NC)CN(C)C1 |
| InChI | InChI=1S/C7H16N2.C2H6/c1-4-7(8-2)5-9(3)6-7;1-2/h8H,4-6H2,1-3H3;1-2H3 |
| InChIKey | KSCCOQHKNJKFMH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |