About ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene
ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene (PubChem CID 164905149) has the molecular formula C31H48F2
and a molecular weight of 458.72 g/mol. Its IUPAC name is ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene.
Molecular Properties
| Compound Name | ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene |
| PubChem CID | 164905149 |
| Molecular Formula | C31H48F2 |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.37 |
| IUPAC Name | ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene |
| SMILES | CC.CC.CC.CCc1ccc(F)cc1.CCc1cccc(F)c1.CCc1ccccc1C |
| InChI | InChI=1S/C9H12.2C8H9F.3C2H6/c1-3-9-7-5-4-6-8(9)2;1-2-7-3-5-8(9)6-4-7;1-2-7-4-3-5-8(9)6-7;3*1-2/h4-7H,3H2,1-2H3;2*3-6H,2H2,1H3;3*1-2H3 |
| InChIKey | SUYRBDSPKRHOSQ-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene?
The IUPAC name of ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene (CID 164905149) is ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene.
What is the SMILES notation for ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene?
The canonical SMILES for ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene is CC.CC.CC.CCc1ccc(F)cc1.CCc1cccc(F)c1.CCc1ccccc1C.
What is the InChIKey of ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene?
The InChIKey is SUYRBDSPKRHOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.2C8H9F.3C2H6/c1-3-9-7-5-4-6-8(9)2;1-2-7-3-5-8(9)6-4-7;1-2-7-4-3-5-8(9)6-7;3*1-2/h4-7H,3H2,1-2H3;2*3-6H,2H2,1H3;3*1-2H3.
What are the key properties of ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene?
ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene has a molecular weight of 458.72 g/mol, XLogP of 10.41, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3-fluorobenzene;1-ethyl-4-fluorobenzene;1-ethyl-2-methylbenzene is sourced from PubChem (CID 164905149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).