C21H13NO5 — CID 164906831
2-(4-methyl-13,15-dioxo-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaen-14-yl)acetic acid (PubChem CID 164906831) has the molecular formula C21H13NO5 and a molecular weight of 359.34 g/mol. Its IUPAC name is 2-(4-methyl-13,15-dioxo-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaen-14-yl)acetic acid.
| Compound Name | 2-(4-methyl-13,15-dioxo-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaen-14-yl)acetic acid |
|---|---|
| PubChem CID | 164906831 |
| Molecular Formula | C21H13NO5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-(4-methyl-13,15-dioxo-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaen-14-yl)acetic acid |
| SMILES | Cc1ccc2oc3ccc4c(=O)n(CC(=O)O)c(=O)c5ccc(c2c1)c3c45 |
| InChI | InChI=1S/C21H13NO5/c1-10-2-6-15-14(8-10)11-3-4-12-18-13(5-7-16(27-15)19(11)18)21(26)22(20(12)25)9-17(23)24/h2-8H,9H2,1H3,(H,23,24) |
| InChIKey | IRJKRIVZXOGKEI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|