About 2-formamidoacetic acid;2-methyldibenzofuran
2-formamidoacetic acid;2-methyldibenzofuran (PubChem CID 169198330) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-formamidoacetic acid;2-methyldibenzofuran.
Molecular Properties
| Compound Name | 2-formamidoacetic acid;2-methyldibenzofuran |
| PubChem CID | 169198330 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-formamidoacetic acid;2-methyldibenzofuran |
| SMILES | Cc1ccc2oc3ccccc3c2c1.O=CNCC(=O)O |
| InChI | InChI=1S/C13H10O.C3H5NO3/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13;5-2-4-1-3(6)7/h2-8H,1H3;2H,1H2,(H,4,5)(H,6,7) |
| InChIKey | PRGJEJIGKZVJNP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formamidoacetic acid;2-methyldibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formamidoacetic acid;2-methyldibenzofuran?
The IUPAC name of 2-formamidoacetic acid;2-methyldibenzofuran (CID 169198330) is 2-formamidoacetic acid;2-methyldibenzofuran.
What is the SMILES notation for 2-formamidoacetic acid;2-methyldibenzofuran?
The canonical SMILES for 2-formamidoacetic acid;2-methyldibenzofuran is Cc1ccc2oc3ccccc3c2c1.O=CNCC(=O)O.
What is the InChIKey of 2-formamidoacetic acid;2-methyldibenzofuran?
The InChIKey is PRGJEJIGKZVJNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C3H5NO3/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13;5-2-4-1-3(6)7/h2-8H,1H3;2H,1H2,(H,4,5)(H,6,7).
What are the key properties of 2-formamidoacetic acid;2-methyldibenzofuran?
2-formamidoacetic acid;2-methyldibenzofuran has a molecular weight of 285.30 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formamidoacetic acid;2-methyldibenzofuran is sourced from PubChem (CID 169198330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).