C24H24N3O3+ — CID 8555634
[2-(dibenzofuran-2-ylamino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium (PubChem CID 8555634) has the molecular formula C24H24N3O3+ and a molecular weight of 402.47 g/mol. Its IUPAC name is [2-(dibenzofuran-2-ylamino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(dibenzofuran-2-ylamino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8555634 |
| Molecular Formula | C24H24N3O3+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [2-(dibenzofuran-2-ylamino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc3oc4ccccc4c3c2)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-16-7-9-17(10-8-16)25-23(28)14-27(2)15-24(29)26-18-11-12-22-20(13-18)19-5-3-4-6-21(19)30-22/h3-13H,14-15H2,1-2H3,(H,25,28)(H,26,29)/p+1 |
| InChIKey | CFPYXHBSQBJQHK-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |