C19H22Cl2N3O3S- — CID 164907224
2-amino-1-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-3-(2,4-dichlorophenyl)propan-1-one;methanesulfinate (PubChem CID 164907224) has the molecular formula C19H22Cl2N3O3S- and a molecular weight of 443.38 g/mol. Its IUPAC name is 2-amino-1-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-3-(2,4-dichlorophenyl)propan-1-one;methanesulfinate.
| Compound Name | 2-amino-1-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-3-(2,4-dichlorophenyl)propan-1-one;methanesulfinate |
|---|---|
| PubChem CID | 164907224 |
| Molecular Formula | C19H22Cl2N3O3S- |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-amino-1-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-3-(2,4-dichlorophenyl)propan-1-one;methanesulfinate |
| SMILES | CS(=O)[O-].NCc1ccc2c(c1)CN(C(=O)C(N)Cc1ccc(Cl)cc1Cl)C2 |
| InChI | InChI=1S/C18H19Cl2N3O.CH4O2S/c19-15-4-3-12(16(20)7-15)6-17(22)18(24)23-9-13-2-1-11(8-21)5-14(13)10-23;1-4(2)3/h1-5,7,17H,6,8-10,21-22H2;1H3,(H,2,3)/p-1 |
| InChIKey | VILIAKSVXGXFGH-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|