C26H27Cl2N5O2 — CID 69193547
1-[2-[2-amino-3-(2,4-dichlorophenyl)propanoyl]-1,3-dihydroisoindol-5-yl]-3-[4-(dimethylamino)phenyl]urea (PubChem CID 69193547) has the molecular formula C26H27Cl2N5O2 and a molecular weight of 512.44 g/mol. Its IUPAC name is 1-[2-[2-amino-3-(2,4-dichlorophenyl)propanoyl]-1,3-dihydroisoindol-5-yl]-3-[4-(dimethylamino)phenyl]urea.
| Compound Name | 1-[2-[2-amino-3-(2,4-dichlorophenyl)propanoyl]-1,3-dihydroisoindol-5-yl]-3-[4-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 69193547 |
| Molecular Formula | C26H27Cl2N5O2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 1-[2-[2-amino-3-(2,4-dichlorophenyl)propanoyl]-1,3-dihydroisoindol-5-yl]-3-[4-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)Nc2ccc3c(c2)CN(C(=O)C(N)Cc2ccc(Cl)cc2Cl)C3)cc1 |
| InChI | InChI=1S/C26H27Cl2N5O2/c1-32(2)22-9-7-20(8-10-22)30-26(35)31-21-6-4-17-14-33(15-18(17)11-21)25(34)24(29)12-16-3-5-19(27)13-23(16)28/h3-11,13,24H,12,14-15,29H2,1-2H3,(H2,30,31,35) |
| InChIKey | XENAOIBZTXMGBG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|