C16H15ClF2N4O3S — CID 164908361
N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-(2,2-difluoroethoxy)-4,6-dimethoxypyrimidin-2-amine (PubChem CID 164908361) has the molecular formula C16H15ClF2N4O3S and a molecular weight of 416.84 g/mol. Its IUPAC name is N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-(2,2-difluoroethoxy)-4,6-dimethoxypyrimidin-2-amine.
| Compound Name | N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-(2,2-difluoroethoxy)-4,6-dimethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 164908361 |
| Molecular Formula | C16H15ClF2N4O3S |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-(2,2-difluoroethoxy)-4,6-dimethoxypyrimidin-2-amine |
| SMILES | COc1nc(NSc2c[nH]c3cc(Cl)ccc23)nc(OC)c1OCC(F)F |
| InChI | InChI=1S/C16H15ClF2N4O3S/c1-24-14-13(26-7-12(18)19)15(25-2)22-16(21-14)23-27-11-6-20-10-5-8(17)3-4-9(10)11/h3-6,12,20H,7H2,1-2H3,(H,21,22,23) |
| InChIKey | AEAQGHGKXNZUQK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|