C21H18F4N6O2S — CID 170742676
5-(2,2-difluoroethyl)-N-[[6-(difluoromethyl)-7-pyrimidin-2-yl-1H-indol-3-yl]sulfanyl]-4,6-dimethoxypyrimidin-2-amine (PubChem CID 170742676) has the molecular formula C21H18F4N6O2S and a molecular weight of 494.47 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-N-[[6-(difluoromethyl)-7-pyrimidin-2-yl-1H-indol-3-yl]sulfanyl]-4,6-dimethoxypyrimidin-2-amine.
| Compound Name | 5-(2,2-difluoroethyl)-N-[[6-(difluoromethyl)-7-pyrimidin-2-yl-1H-indol-3-yl]sulfanyl]-4,6-dimethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 170742676 |
| Molecular Formula | C21H18F4N6O2S |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 5-(2,2-difluoroethyl)-N-[[6-(difluoromethyl)-7-pyrimidin-2-yl-1H-indol-3-yl]sulfanyl]-4,6-dimethoxypyrimidin-2-amine |
| SMILES | COc1nc(NSc2c[nH]c3c(-c4ncccn4)c(C(F)F)ccc23)nc(OC)c1CC(F)F |
| InChI | InChI=1S/C21H18F4N6O2S/c1-32-19-12(8-14(22)23)20(33-2)30-21(29-19)31-34-13-9-28-16-10(13)4-5-11(17(24)25)15(16)18-26-6-3-7-27-18/h3-7,9,14,17,28H,8H2,1-2H3,(H,29,30,31) |
| InChIKey | WYCVOYBZFMKCJS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|