C23H24F2N6OS — CID 170742598
4-butan-2-yl-5-(2,2-difluoroethyl)-6-methoxy-N-[(7-pyrazin-2-yl-1H-indol-3-yl)sulfanyl]pyrimidin-2-amine (PubChem CID 170742598) has the molecular formula C23H24F2N6OS and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-butan-2-yl-5-(2,2-difluoroethyl)-6-methoxy-N-[(7-pyrazin-2-yl-1H-indol-3-yl)sulfanyl]pyrimidin-2-amine.
| Compound Name | 4-butan-2-yl-5-(2,2-difluoroethyl)-6-methoxy-N-[(7-pyrazin-2-yl-1H-indol-3-yl)sulfanyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170742598 |
| Molecular Formula | C23H24F2N6OS |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-butan-2-yl-5-(2,2-difluoroethyl)-6-methoxy-N-[(7-pyrazin-2-yl-1H-indol-3-yl)sulfanyl]pyrimidin-2-amine |
| SMILES | CCC(C)c1nc(NSc2c[nH]c3c(-c4cnccn4)cccc23)nc(OC)c1CC(F)F |
| InChI | InChI=1S/C23H24F2N6OS/c1-4-13(2)20-16(10-19(24)25)22(32-3)30-23(29-20)31-33-18-12-28-21-14(6-5-7-15(18)21)17-11-26-8-9-27-17/h5-9,11-13,19,28H,4,10H2,1-3H3,(H,29,30,31) |
| InChIKey | UGYIQFYRHMDAIE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|