C20H20F2N6O2S — CID 170742807
5-(2,2-difluoroethyl)-4,6-dimethoxy-N-[(6-methyl-7-pyrazol-1-yl-1H-indol-3-yl)sulfanyl]pyrimidin-2-amine (PubChem CID 170742807) has the molecular formula C20H20F2N6O2S and a molecular weight of 446.48 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-4,6-dimethoxy-N-[(6-methyl-7-pyrazol-1-yl-1H-indol-3-yl)sulfanyl]pyrimidin-2-amine.
| Compound Name | 5-(2,2-difluoroethyl)-4,6-dimethoxy-N-[(6-methyl-7-pyrazol-1-yl-1H-indol-3-yl)sulfanyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170742807 |
| Molecular Formula | C20H20F2N6O2S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 5-(2,2-difluoroethyl)-4,6-dimethoxy-N-[(6-methyl-7-pyrazol-1-yl-1H-indol-3-yl)sulfanyl]pyrimidin-2-amine |
| SMILES | COc1nc(NSc2c[nH]c3c(-n4cccn4)c(C)ccc23)nc(OC)c1CC(F)F |
| InChI | InChI=1S/C20H20F2N6O2S/c1-11-5-6-12-14(10-23-16(12)17(11)28-8-4-7-24-28)31-27-20-25-18(29-2)13(9-15(21)22)19(26-20)30-3/h4-8,10,15,23H,9H2,1-3H3,(H,25,26,27) |
| InChIKey | WNKKWIZMMIOGLA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|