C18H21ClN6OS — CID 164908128
3-[2-[(6-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)sulfanylamino]-4-methoxy-6-methylpyrimidin-5-yl]propanenitrile;ethane (PubChem CID 164908128) has the molecular formula C18H21ClN6OS and a molecular weight of 404.93 g/mol. Its IUPAC name is 3-[2-[(6-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)sulfanylamino]-4-methoxy-6-methylpyrimidin-5-yl]propanenitrile;ethane.
| Compound Name | 3-[2-[(6-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)sulfanylamino]-4-methoxy-6-methylpyrimidin-5-yl]propanenitrile;ethane |
|---|---|
| PubChem CID | 164908128 |
| Molecular Formula | C18H21ClN6OS |
| Molecular Weight | 404.93 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 3-[2-[(6-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)sulfanylamino]-4-methoxy-6-methylpyrimidin-5-yl]propanenitrile;ethane |
| SMILES | CC.COc1nc(NSc2c[nH]c3nc(Cl)ccc23)nc(C)c1CCC#N |
| InChI | InChI=1S/C16H15ClN6OS.C2H6/c1-9-10(4-3-7-18)15(24-2)22-16(20-9)23-25-12-8-19-14-11(12)5-6-13(17)21-14;1-2/h5-6,8H,3-4H2,1-2H3,(H,19,21)(H,20,22,23);1-2H3 |
| InChIKey | WFGMBWYSBDUZFY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|