C15H13ClF3N5O5S — CID 169225635
6-chloro-N-[4,6-dimethoxy-5-(1,1,2-trifluoroethoxy)pyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide (PubChem CID 169225635) has the molecular formula C15H13ClF3N5O5S and a molecular weight of 467.81 g/mol. Its IUPAC name is 6-chloro-N-[4,6-dimethoxy-5-(1,1,2-trifluoroethoxy)pyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[4,6-dimethoxy-5-(1,1,2-trifluoroethoxy)pyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 169225635 |
| Molecular Formula | C15H13ClF3N5O5S |
| Molecular Weight | 467.81 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 6-chloro-N-[4,6-dimethoxy-5-(1,1,2-trifluoroethoxy)pyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
| SMILES | COc1nc(NS(=O)(=O)c2c[nH]c3nc(Cl)ccc23)nc(OC)c1OC(F)(F)CF |
| InChI | InChI=1S/C15H13ClF3N5O5S/c1-27-12-10(29-15(18,19)6-17)13(28-2)23-14(22-12)24-30(25,26)8-5-20-11-7(8)3-4-9(16)21-11/h3-5H,6H2,1-2H3,(H,20,21)(H,22,23,24) |
| InChIKey | JZYLADPOAABTTI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|