C16H15ClN6O4S — CID 169225680
6-chloro-N-[5-(2-cyanoethyl)-4,6-dimethoxypyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide (PubChem CID 169225680) has the molecular formula C16H15ClN6O4S and a molecular weight of 422.85 g/mol. Its IUPAC name is 6-chloro-N-[5-(2-cyanoethyl)-4,6-dimethoxypyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[5-(2-cyanoethyl)-4,6-dimethoxypyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 169225680 |
| Molecular Formula | C16H15ClN6O4S |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 6-chloro-N-[5-(2-cyanoethyl)-4,6-dimethoxypyrimidin-2-yl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
| SMILES | COc1nc(NS(=O)(=O)c2c[nH]c3nc(Cl)ccc23)nc(OC)c1CCC#N |
| InChI | InChI=1S/C16H15ClN6O4S/c1-26-14-10(4-3-7-18)15(27-2)22-16(21-14)23-28(24,25)11-8-19-13-9(11)5-6-12(17)20-13/h5-6,8H,3-4H2,1-2H3,(H,19,20)(H,21,22,23) |
| InChIKey | NQSCCPZJNSUICC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|