C13H8Cl2FN3O2S — CID 135201156
6-chloro-N-(4-chloro-2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide (PubChem CID 135201156) has the molecular formula C13H8Cl2FN3O2S and a molecular weight of 360.20 g/mol. Its IUPAC name is 6-chloro-N-(4-chloro-2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(4-chloro-2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 135201156 |
| Molecular Formula | C13H8Cl2FN3O2S |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 6-chloro-N-(4-chloro-2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1F)c1c[nH]c2nc(Cl)ccc12 |
| InChI | InChI=1S/C13H8Cl2FN3O2S/c14-7-1-3-10(9(16)5-7)19-22(20,21)11-6-17-13-8(11)2-4-12(15)18-13/h1-6,19H,(H,17,18) |
| InChIKey | NDGOYFOMMPWGNH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|