C14H7ClF3N3O4S — CID 175359279
6-chloro-N-(2,4,6-trifluoro-1,3-benzodioxol-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide (PubChem CID 175359279) has the molecular formula C14H7ClF3N3O4S and a molecular weight of 405.74 g/mol. Its IUPAC name is 6-chloro-N-(2,4,6-trifluoro-1,3-benzodioxol-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(2,4,6-trifluoro-1,3-benzodioxol-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 175359279 |
| Molecular Formula | C14H7ClF3N3O4S |
| Molecular Weight | 405.74 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 6-chloro-N-(2,4,6-trifluoro-1,3-benzodioxol-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1c(F)cc2c(c1F)OC(F)O2)c1c[nH]c2nc(Cl)ccc12 |
| InChI | InChI=1S/C14H7ClF3N3O4S/c15-9-2-1-5-8(4-19-13(5)20-9)26(22,23)21-11-6(16)3-7-12(10(11)17)25-14(18)24-7/h1-4,14,21H,(H,19,20) |
| InChIKey | XICYLZYPDSXKDK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|