C9H12N4O2 — CID 164908424
3-(2-amino-4,6-dimethoxypyrimidin-5-yl)propanenitrile (PubChem CID 164908424) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-(2-amino-4,6-dimethoxypyrimidin-5-yl)propanenitrile.
| Compound Name | 3-(2-amino-4,6-dimethoxypyrimidin-5-yl)propanenitrile |
|---|---|
| PubChem CID | 164908424 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-(2-amino-4,6-dimethoxypyrimidin-5-yl)propanenitrile |
| SMILES | COc1nc(N)nc(OC)c1CCC#N |
| InChI | InChI=1S/C9H12N4O2/c1-14-7-6(4-3-5-10)8(15-2)13-9(11)12-7/h3-4H2,1-2H3,(H2,11,12,13) |
| InChIKey | AZLIFKGLIQWEHB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |