C9H15N3O4S — CID 164907958
4,6-dimethoxy-5-(2-methylsulfonylethyl)pyrimidin-2-amine (PubChem CID 164907958) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is 4,6-dimethoxy-5-(2-methylsulfonylethyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-5-(2-methylsulfonylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 164907958 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4,6-dimethoxy-5-(2-methylsulfonylethyl)pyrimidin-2-amine |
| SMILES | COc1nc(N)nc(OC)c1CCS(C)(=O)=O |
| InChI | InChI=1S/C9H15N3O4S/c1-15-7-6(4-5-17(3,13)14)8(16-2)12-9(10)11-7/h4-5H2,1-3H3,(H2,10,11,12) |
| InChIKey | FUKGCVODMGYWPA-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |