C9H12F3N3O2 — CID 175471206
4,6-dimethoxy-5-(2,3,3-trifluoropropyl)pyrimidin-2-amine (PubChem CID 175471206) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is 4,6-dimethoxy-5-(2,3,3-trifluoropropyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-5-(2,3,3-trifluoropropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 175471206 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4,6-dimethoxy-5-(2,3,3-trifluoropropyl)pyrimidin-2-amine |
| SMILES | COc1nc(N)nc(OC)c1CC(F)C(F)F |
| InChI | InChI=1S/C9H12F3N3O2/c1-16-7-4(3-5(10)6(11)12)8(17-2)15-9(13)14-7/h5-6H,3H2,1-2H3,(H2,13,14,15) |
| InChIKey | PRMIZLSTEIRQFR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |