C14H26O — CID 164909441
3,7-dimethyl-5-(2-methylpropyl)oct-4-enal (PubChem CID 164909441) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 3,7-dimethyl-5-(2-methylpropyl)oct-4-enal.
| Compound Name | 3,7-dimethyl-5-(2-methylpropyl)oct-4-enal |
|---|---|
| PubChem CID | 164909441 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 3,7-dimethyl-5-(2-methylpropyl)oct-4-enal |
| SMILES | CC(C)CC(=CC(C)CC=O)CC(C)C |
| InChI | InChI=1S/C14H26O/c1-11(2)8-14(9-12(3)4)10-13(5)6-7-15/h7,10-13H,6,8-9H2,1-5H3 |
| InChIKey | JSGGOQUKXVGBCS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|