About 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol
1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol (PubChem CID 164911617) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol.
Analyze 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol?
The IUPAC name of 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol (CID 164911617) is 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol.
What is the SMILES notation for 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol?
The canonical SMILES for 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol is Cc1cnn(CC2(O)CC2)c1C.
What is the InChIKey of 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol?
The InChIKey is PEFKJLPHKVQCOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-7-5-10-11(8(7)2)6-9(12)3-4-9/h5,12H,3-4,6H2,1-2H3.
What are the key properties of 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol?
1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol has a molecular weight of 166.22 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,5-dimethylpyrazol-1-yl)methyl]cyclopropan-1-ol is sourced from PubChem (CID 164911617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).