C31H31F3N4O4 — CID 164914962
5-[3-[4-[[3-cyclopropyl-4-(trifluoromethoxy)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 164914962) has the molecular formula C31H31F3N4O4 and a molecular weight of 580.61 g/mol. Its IUPAC name is 5-[3-[4-[[3-cyclopropyl-4-(trifluoromethoxy)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[3-[4-[[3-cyclopropyl-4-(trifluoromethoxy)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 164914962 |
| Molecular Formula | C31H31F3N4O4 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 5-[3-[4-[[3-cyclopropyl-4-(trifluoromethoxy)phenyl]methylamino]butoxy]azetidin-1-yl]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(N1CC(OCCCCNCc3ccc(OC(F)(F)F)c(C4CC4)c3)C1)c1ccncc12 |
| InChI | InChI=1S/C31H31F3N4O4/c32-31(33,34)42-28-8-3-19(13-25(28)20-4-5-20)15-35-10-1-2-12-41-22-17-38(18-22)29-24-9-11-36-16-26(24)23-7-6-21(30(39)40)14-27(23)37-29/h3,6-9,11,13-14,16,20,22,35H,1-2,4-5,10,12,15,17-18H2,(H,39,40) |
| InChIKey | HHGDGVNOHBAHKJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|