C28H29ClF3N5O3 — CID 164914976
5-[[(2S)-1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164914976) has the molecular formula C28H29ClF3N5O3 and a molecular weight of 576.02 g/mol. Its IUPAC name is 5-[[(2S)-1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[[(2S)-1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164914976 |
| Molecular Formula | C28H29ClF3N5O3 |
| Molecular Weight | 576.02 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 5-[[(2S)-1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | C[C@@H](COCCCCNCc1ccc(OC(F)(F)F)c(Cl)c1)Nc1nc2cc(C(N)=O)ccc2c2cnccc12 |
| InChI | InChI=1S/C28H29ClF3N5O3/c1-17(16-39-11-3-2-9-34-14-18-4-7-25(23(29)12-18)40-28(30,31)32)36-27-21-8-10-35-15-22(21)20-6-5-19(26(33)38)13-24(20)37-27/h4-8,10,12-13,15,17,34H,2-3,9,11,14,16H2,1H3,(H2,33,38)(H,36,37)/t17-/m0/s1 |
| InChIKey | KEXVDKQNGWPBHW-KRWDZBQOSA-N |
| XLogP | 5.82 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.02 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|